ChemNet > CAS > 175278-51-0 3-{2-[(4-chlorophenyl)thio]-5-nitrophenyl}acrylic acid
175278-51-0 3-{2-[(4-chlorophenyl)thio]-5-nitrophenyl}acrylic acid
| product Name |
3-{2-[(4-chlorophenyl)thio]-5-nitrophenyl}acrylic acid |
| CAS No |
175278-51-0 |
| Synonyms |
3-[2-[(4-Chlorophenyl)thio]-5-nitrophenyl]acrylic acid; (2Z)-3-{2-[(4-chlorophenyl)sulfanyl]-5-nitrophenyl}prop-2-enoic acid |
| Molecular Formula |
C15H10ClNO4S |
| Molecular Weight |
335.7622 |
| InChI |
InChI=1/C15H10ClNO4S/c16-11-2-5-13(6-3-11)22-14-7-4-12(17(20)21)9-10(14)1-8-15(18)19/h1-9H,(H,18,19)/b8-1- |
| Molecular Structure |
![175278-51-0 3-{2-[(4-chlorophenyl)thio]-5-nitrophenyl}acrylic acid](https://images-a.chemnet.com/suppliers/chembase/309/30947.gif)
|
| Density |
1.5g/cm3 |
| Melting point |
212℃ |
| Boiling point |
531.7°C at 760 mmHg |
| Refractive index |
1.694 |
| Flash point |
275.4°C |
| Vapour Pressur |
3.9E-12mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
